C21H18BrN3 — CID 3341400
2-amino-6-(4-bromophenyl)-4-(4-ethylphenyl)-5-methylpyridine-3-carbonitrile (PubChem CID 3341400) has the molecular formula C21H18BrN3 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-amino-6-(4-bromophenyl)-4-(4-ethylphenyl)-5-methylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-bromophenyl)-4-(4-ethylphenyl)-5-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3341400 |
| Molecular Formula | C21H18BrN3 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 2-amino-6-(4-bromophenyl)-4-(4-ethylphenyl)-5-methylpyridine-3-carbonitrile |
| SMILES | CCc1ccc(-c2c(C)c(-c3ccc(Br)cc3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C21H18BrN3/c1-3-14-4-6-15(7-5-14)19-13(2)20(25-21(24)18(19)12-23)16-8-10-17(22)11-9-16/h4-11H,3H2,1-2H3,(H2,24,25) |
| InChIKey | ZMQXPNDUYISRSI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |