C25H26BrN3O — CID 3343274
2-amino-6-(4-bromophenyl)-4-(4-hexoxyphenyl)-5-methylpyridine-3-carbonitrile (PubChem CID 3343274) has the molecular formula C25H26BrN3O and a molecular weight of 464.41 g/mol. Its IUPAC name is 2-amino-6-(4-bromophenyl)-4-(4-hexoxyphenyl)-5-methylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-bromophenyl)-4-(4-hexoxyphenyl)-5-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3343274 |
| Molecular Formula | C25H26BrN3O |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 2-amino-6-(4-bromophenyl)-4-(4-hexoxyphenyl)-5-methylpyridine-3-carbonitrile |
| SMILES | CCCCCCOc1ccc(-c2c(C)c(-c3ccc(Br)cc3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C25H26BrN3O/c1-3-4-5-6-15-30-21-13-9-18(10-14-21)23-17(2)24(29-25(28)22(23)16-27)19-7-11-20(26)12-8-19/h7-14H,3-6,15H2,1-2H3,(H2,28,29) |
| InChIKey | RTYYRTHSMPQRLH-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|