C26H35N3O — CID 3277776
2-amino-4-(4-heptoxyphenyl)-6-propyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 3277776) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-amino-4-(4-heptoxyphenyl)-6-propyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-(4-heptoxyphenyl)-6-propyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3277776 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 2-amino-4-(4-heptoxyphenyl)-6-propyl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CCCCCCCOc1ccc(-c2c(C#N)c(N)nc3c2CC(CCC)CC3)cc1 |
| InChI | InChI=1S/C26H35N3O/c1-3-5-6-7-8-16-30-21-13-11-20(12-14-21)25-22-17-19(9-4-2)10-15-24(22)29-26(28)23(25)18-27/h11-14,19H,3-10,15-17H2,1-2H3,(H2,28,29) |
| InChIKey | SEWQCPKFGRSHNR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|