C20H25N5O — CID 56884364
2-amino-4-[4-[3-(dimethylamino)propoxy]phenyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile (PubChem CID 56884364) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-amino-4-[4-[3-(dimethylamino)propoxy]phenyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[4-[3-(dimethylamino)propoxy]phenyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56884364 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-amino-4-[4-[3-(dimethylamino)propoxy]phenyl]-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile |
| SMILES | CN(C)CCCOc1ccc(-c2c(C#N)c(N)nc3c2CNCC3)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-25(2)10-3-11-26-15-6-4-14(5-7-15)19-16(12-21)20(22)24-18-8-9-23-13-17(18)19/h4-7,23H,3,8-11,13H2,1-2H3,(H2,22,24) |
| InChIKey | DPSZRRGPTLRCEW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|