C18H17ClN4O — CID 56899428
2-amino-4-(5-chloro-2-prop-2-enoxyphenyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile (PubChem CID 56899428) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 2-amino-4-(5-chloro-2-prop-2-enoxyphenyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(5-chloro-2-prop-2-enoxyphenyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 56899428 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-amino-4-(5-chloro-2-prop-2-enoxyphenyl)-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile |
| SMILES | C=CCOc1ccc(Cl)cc1-c1c(C#N)c(N)nc2c1CNCC2 |
| InChI | InChI=1S/C18H17ClN4O/c1-2-7-24-16-4-3-11(19)8-12(16)17-13(9-20)18(21)23-15-5-6-22-10-14(15)17/h2-4,8,22H,1,5-7,10H2,(H2,21,23) |
| InChIKey | AUBQKMOJCVHPCK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|