C14H12ClN5O — CID 169397431
2,4-diamino-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile (PubChem CID 169397431) has the molecular formula C14H12ClN5O and a molecular weight of 301.74 g/mol. Its IUPAC name is 2,4-diamino-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169397431 |
| Molecular Formula | C14H12ClN5O |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2,4-diamino-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile |
| SMILES | C=CCOc1ccc(Cl)cc1-c1nc(N)nc(N)c1C#N |
| InChI | InChI=1S/C14H12ClN5O/c1-2-5-21-11-4-3-8(15)6-9(11)12-10(7-16)13(17)20-14(18)19-12/h2-4,6H,1,5H2,(H4,17,18,19,20) |
| InChIKey | KZZDOLXIJIEBCC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|