C15H13Br2N5O2 — CID 169398071
2,4-diamino-6-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile (PubChem CID 169398071) has the molecular formula C15H13Br2N5O2 and a molecular weight of 455.11 g/mol. Its IUPAC name is 2,4-diamino-6-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398071 |
| Molecular Formula | C15H13Br2N5O2 |
| Molecular Weight | 455.11 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | 2,4-diamino-6-(2,3-dibromo-5-methoxy-4-prop-2-enoxyphenyl)pyrimidine-5-carbonitrile |
| SMILES | C=CCOc1c(OC)cc(-c2nc(N)nc(N)c2C#N)c(Br)c1Br |
| InChI | InChI=1S/C15H13Br2N5O2/c1-3-4-24-13-9(23-2)5-7(10(16)11(13)17)12-8(6-18)14(19)22-15(20)21-12/h3,5H,1,4H2,2H3,(H4,19,20,21,22) |
| InChIKey | AWIXOQQHELTOOC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.11 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|