C16H18IN5O2 — CID 169398080
2,4-diamino-6-(4-butoxy-3-iodo-5-methoxyphenyl)pyrimidine-5-carbonitrile (PubChem CID 169398080) has the molecular formula C16H18IN5O2 and a molecular weight of 439.26 g/mol. Its IUPAC name is 2,4-diamino-6-(4-butoxy-3-iodo-5-methoxyphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(4-butoxy-3-iodo-5-methoxyphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398080 |
| Molecular Formula | C16H18IN5O2 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2,4-diamino-6-(4-butoxy-3-iodo-5-methoxyphenyl)pyrimidine-5-carbonitrile |
| SMILES | CCCCOc1c(I)cc(-c2nc(N)nc(N)c2C#N)cc1OC |
| InChI | InChI=1S/C16H18IN5O2/c1-3-4-5-24-14-11(17)6-9(7-12(14)23-2)13-10(8-18)15(19)22-16(20)21-13/h6-7H,3-5H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | CMKXRXNRVNSHAZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|