C14H13BrIN5O — CID 169398106
2,4-diamino-6-(5-bromo-3-iodo-2-propoxyphenyl)pyrimidine-5-carbonitrile (PubChem CID 169398106) has the molecular formula C14H13BrIN5O and a molecular weight of 474.10 g/mol. Its IUPAC name is 2,4-diamino-6-(5-bromo-3-iodo-2-propoxyphenyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-(5-bromo-3-iodo-2-propoxyphenyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169398106 |
| Molecular Formula | C14H13BrIN5O |
| Molecular Weight | 474.10 g/mol |
| Exact Mass | 472.93 |
| IUPAC Name | 2,4-diamino-6-(5-bromo-3-iodo-2-propoxyphenyl)pyrimidine-5-carbonitrile |
| SMILES | CCCOc1c(I)cc(Br)cc1-c1nc(N)nc(N)c1C#N |
| InChI | InChI=1S/C14H13BrIN5O/c1-2-3-22-12-8(4-7(15)5-10(12)16)11-9(6-17)13(18)21-14(19)20-11/h4-5H,2-3H2,1H3,(H4,18,19,20,21) |
| InChIKey | NXGMGIDHLWFWKZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.10 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|