C19H16Cl2N4O — CID 59788248
4-N-(4-chlorophenyl)-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 59788248) has the molecular formula C19H16Cl2N4O and a molecular weight of 387.27 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-chlorophenyl)-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59788248 |
| Molecular Formula | C19H16Cl2N4O |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-N-(4-chlorophenyl)-6-(5-chloro-2-prop-2-enoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | C=CCOc1ccc(Cl)cc1-c1cc(Nc2ccc(Cl)cc2)nc(N)n1 |
| InChI | InChI=1S/C19H16Cl2N4O/c1-2-9-26-17-8-5-13(21)10-15(17)16-11-18(25-19(22)24-16)23-14-6-3-12(20)4-7-14/h2-8,10-11H,1,9H2,(H3,22,23,24,25) |
| InChIKey | BALCMWSCWDBPLJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|