C18H15Cl2N5O — CID 74818738
N-[1-[4-[[2-amino-6-(2,5-dichlorophenyl)pyrimidin-4-yl]amino]phenyl]ethylidene]hydroxylamine (PubChem CID 74818738) has the molecular formula C18H15Cl2N5O and a molecular weight of 388.26 g/mol. Its IUPAC name is N-[1-[4-[[2-amino-6-(2,5-dichlorophenyl)pyrimidin-4-yl]amino]phenyl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[4-[[2-amino-6-(2,5-dichlorophenyl)pyrimidin-4-yl]amino]phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 74818738 |
| Molecular Formula | C18H15Cl2N5O |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N-[1-[4-[[2-amino-6-(2,5-dichlorophenyl)pyrimidin-4-yl]amino]phenyl]ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1ccc(Nc2cc(-c3cc(Cl)ccc3Cl)nc(N)n2)cc1 |
| InChI | InChI=1S/C18H15Cl2N5O/c1-10(25-26)11-2-5-13(6-3-11)22-17-9-16(23-18(21)24-17)14-8-12(19)4-7-15(14)20/h2-9,26H,1H3,(H3,21,22,23,24) |
| InChIKey | UHANTTLNKLNKPN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|