C21H17BrClN3O — CID 3317609
2-amino-4-(5-bromo-2-ethoxyphenyl)-6-(4-chlorophenyl)-5-methylpyridine-3-carbonitrile (PubChem CID 3317609) has the molecular formula C21H17BrClN3O and a molecular weight of 442.74 g/mol. Its IUPAC name is 2-amino-4-(5-bromo-2-ethoxyphenyl)-6-(4-chlorophenyl)-5-methylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(5-bromo-2-ethoxyphenyl)-6-(4-chlorophenyl)-5-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3317609 |
| Molecular Formula | C21H17BrClN3O |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 2-amino-4-(5-bromo-2-ethoxyphenyl)-6-(4-chlorophenyl)-5-methylpyridine-3-carbonitrile |
| SMILES | CCOc1ccc(Br)cc1-c1c(C)c(-c2ccc(Cl)cc2)nc(N)c1C#N |
| InChI | InChI=1S/C21H17BrClN3O/c1-3-27-18-9-6-14(22)10-16(18)19-12(2)20(26-21(25)17(19)11-24)13-4-7-15(23)8-5-13/h4-10H,3H2,1-2H3,(H2,25,26) |
| InChIKey | XJBLOESPWQFRDQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |