C19H12BrClFN3 — CID 3326018
2-amino-4-(5-bromo-2-fluorophenyl)-6-(3-chlorophenyl)-5-methylpyridine-3-carbonitrile (PubChem CID 3326018) has the molecular formula C19H12BrClFN3 and a molecular weight of 416.68 g/mol. Its IUPAC name is 2-amino-4-(5-bromo-2-fluorophenyl)-6-(3-chlorophenyl)-5-methylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(5-bromo-2-fluorophenyl)-6-(3-chlorophenyl)-5-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3326018 |
| Molecular Formula | C19H12BrClFN3 |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2-amino-4-(5-bromo-2-fluorophenyl)-6-(3-chlorophenyl)-5-methylpyridine-3-carbonitrile |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc(N)c(C#N)c1-c1cc(Br)ccc1F |
| InChI | InChI=1S/C19H12BrClFN3/c1-10-17(14-8-12(20)5-6-16(14)22)15(9-23)19(24)25-18(10)11-3-2-4-13(21)7-11/h2-8H,1H3,(H2,24,25) |
| InChIKey | IXMFISWDBDWTKA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |