C19H9ClF5N3 — CID 3324150
2-amino-6-(3-chlorophenyl)-5-methyl-4-(2,3,4,5,6-pentafluorophenyl)pyridine-3-carbonitrile (PubChem CID 3324150) has the molecular formula C19H9ClF5N3 and a molecular weight of 409.75 g/mol. Its IUPAC name is 2-amino-6-(3-chlorophenyl)-5-methyl-4-(2,3,4,5,6-pentafluorophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(3-chlorophenyl)-5-methyl-4-(2,3,4,5,6-pentafluorophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3324150 |
| Molecular Formula | C19H9ClF5N3 |
| Molecular Weight | 409.75 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 2-amino-6-(3-chlorophenyl)-5-methyl-4-(2,3,4,5,6-pentafluorophenyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc(N)c(C#N)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H9ClF5N3/c1-7-11(12-13(21)15(23)17(25)16(24)14(12)22)10(6-26)19(27)28-18(7)8-3-2-4-9(20)5-8/h2-5H,1H3,(H2,27,28) |
| InChIKey | POEGSYGESSGXPM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.75 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|