C12H9ClN4S — CID 14579964
4-amino-6-(3-chlorophenyl)-2-methylsulfanylpyrimidine-5-carbonitrile (PubChem CID 14579964) has the molecular formula C12H9ClN4S and a molecular weight of 276.75 g/mol. Its IUPAC name is 4-amino-6-(3-chlorophenyl)-2-methylsulfanylpyrimidine-5-carbonitrile.
| Compound Name | 4-amino-6-(3-chlorophenyl)-2-methylsulfanylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 14579964 |
| Molecular Formula | C12H9ClN4S |
| Molecular Weight | 276.75 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 4-amino-6-(3-chlorophenyl)-2-methylsulfanylpyrimidine-5-carbonitrile |
| SMILES | CSc1nc(N)c(C#N)c(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C12H9ClN4S/c1-18-12-16-10(9(6-14)11(15)17-12)7-3-2-4-8(13)5-7/h2-5H,1H3,(H2,15,16,17) |
| InChIKey | XCXJQDSXHLSOBB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |