C26H29N3O2 — CID 5241329
2-amino-6-(4-ethoxyphenyl)-4-(4-hexoxyphenyl)pyridine-3-carbonitrile (PubChem CID 5241329) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-amino-6-(4-ethoxyphenyl)-4-(4-hexoxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-ethoxyphenyl)-4-(4-hexoxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5241329 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 2-amino-6-(4-ethoxyphenyl)-4-(4-hexoxyphenyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCOc1ccc(-c2cc(-c3ccc(OCC)cc3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C26H29N3O2/c1-3-5-6-7-16-31-22-12-8-19(9-13-22)23-17-25(29-26(28)24(23)18-27)20-10-14-21(15-11-20)30-4-2/h8-15,17H,3-7,16H2,1-2H3,(H2,28,29) |
| InChIKey | LIQMRFGFXDHNFC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|