C21H19N3O — CID 3363551
2-amino-4-(4-ethoxyphenyl)-6-(4-methylphenyl)pyridine-3-carbonitrile (PubChem CID 3363551) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-amino-4-(4-ethoxyphenyl)-6-(4-methylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-ethoxyphenyl)-6-(4-methylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3363551 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 2-amino-4-(4-ethoxyphenyl)-6-(4-methylphenyl)pyridine-3-carbonitrile |
| SMILES | CCOc1ccc(-c2cc(-c3ccc(C)cc3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C21H19N3O/c1-3-25-17-10-8-15(9-11-17)18-12-20(24-21(23)19(18)13-22)16-6-4-14(2)5-7-16/h4-12H,3H2,1-2H3,(H2,23,24) |
| InChIKey | JTFYVXYDAVYKOG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |