C18H15N3OS — CID 44817564
2-amino-4-(4-ethoxyphenyl)-6-thiophen-3-ylpyridine-3-carbonitrile (PubChem CID 44817564) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-amino-4-(4-ethoxyphenyl)-6-thiophen-3-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-ethoxyphenyl)-6-thiophen-3-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 44817564 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-amino-4-(4-ethoxyphenyl)-6-thiophen-3-ylpyridine-3-carbonitrile |
| SMILES | CCOc1ccc(-c2cc(-c3ccsc3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C18H15N3OS/c1-2-22-14-5-3-12(4-6-14)15-9-17(13-7-8-23-11-13)21-18(20)16(15)10-19/h3-9,11H,2H2,1H3,(H2,20,21) |
| InChIKey | WZCMWVDGUSMHBO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |