C16H10ClN3S — CID 44817568
2-amino-4-(4-chlorophenyl)-6-thiophen-3-ylpyridine-3-carbonitrile (PubChem CID 44817568) has the molecular formula C16H10ClN3S and a molecular weight of 311.80 g/mol. Its IUPAC name is 2-amino-4-(4-chlorophenyl)-6-thiophen-3-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-chlorophenyl)-6-thiophen-3-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 44817568 |
| Molecular Formula | C16H10ClN3S |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-amino-4-(4-chlorophenyl)-6-thiophen-3-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)cc(-c2ccsc2)nc1N |
| InChI | InChI=1S/C16H10ClN3S/c17-12-3-1-10(2-4-12)13-7-15(11-5-6-21-9-11)20-16(19)14(13)8-18/h1-7,9H,(H2,19,20) |
| InChIKey | SPMUNRZBGWCOPD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |