C24H16ClN3 — CID 139222472
2-amino-4-[3-(4-chlorophenyl)phenyl]-6-phenylpyridine-3-carbonitrile (PubChem CID 139222472) has the molecular formula C24H16ClN3 and a molecular weight of 381.87 g/mol. Its IUPAC name is 2-amino-4-[3-(4-chlorophenyl)phenyl]-6-phenylpyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[3-(4-chlorophenyl)phenyl]-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139222472 |
| Molecular Formula | C24H16ClN3 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-amino-4-[3-(4-chlorophenyl)phenyl]-6-phenylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccc(-c3ccc(Cl)cc3)c2)cc(-c2ccccc2)nc1N |
| InChI | InChI=1S/C24H16ClN3/c25-20-11-9-16(10-12-20)18-7-4-8-19(13-18)21-14-23(17-5-2-1-3-6-17)28-24(27)22(21)15-26/h1-14H,(H2,27,28) |
| InChIKey | FFDQDTYKSSIOOQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |