C30H37N3O — CID 5088898
2-amino-6-[4-(2-methylpropyl)phenyl]-4-(4-octoxyphenyl)pyridine-3-carbonitrile (PubChem CID 5088898) has the molecular formula C30H37N3O and a molecular weight of 455.65 g/mol. Its IUPAC name is 2-amino-6-[4-(2-methylpropyl)phenyl]-4-(4-octoxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-[4-(2-methylpropyl)phenyl]-4-(4-octoxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5088898 |
| Molecular Formula | C30H37N3O |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 2-amino-6-[4-(2-methylpropyl)phenyl]-4-(4-octoxyphenyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCCCOc1ccc(-c2cc(-c3ccc(CC(C)C)cc3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C30H37N3O/c1-4-5-6-7-8-9-18-34-26-16-14-24(15-17-26)27-20-29(33-30(32)28(27)21-31)25-12-10-23(11-13-25)19-22(2)3/h10-17,20,22H,4-9,18-19H2,1-3H3,(H2,32,33) |
| InChIKey | YQBQXLMPOFSMQN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|