C25H27N3O — CID 5230485
2-amino-4-(4-hexoxyphenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile (PubChem CID 5230485) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-amino-4-(4-hexoxyphenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-hexoxyphenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5230485 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-amino-4-(4-hexoxyphenyl)-6-(2-methylphenyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCOc1ccc(-c2cc(-c3ccccc3C)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C25H27N3O/c1-3-4-5-8-15-29-20-13-11-19(12-14-20)22-16-24(28-25(27)23(22)17-26)21-10-7-6-9-18(21)2/h6-7,9-14,16H,3-5,8,15H2,1-2H3,(H2,27,28) |
| InChIKey | JSCDQSVNMOGBJZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|