C15H12N4O4 — CID 42598064
methyl 6-amino-5-cyano-2-methyl-4-(4-nitrophenyl)pyridine-3-carboxylate (PubChem CID 42598064) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is methyl 6-amino-5-cyano-2-methyl-4-(4-nitrophenyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-amino-5-cyano-2-methyl-4-(4-nitrophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 42598064 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 6-amino-5-cyano-2-methyl-4-(4-nitrophenyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc(N)c(C#N)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N4O4/c1-8-12(15(20)23-2)13(11(7-16)14(17)18-8)9-3-5-10(6-4-9)19(21)22/h3-6H,1-2H3,(H2,17,18) |
| InChIKey | DJSRIQNTJVEKPV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|