C13H6IN3 — CID 45123386
2-iodo-6-phenylpyridine-3,4-dicarbonitrile (PubChem CID 45123386) has the molecular formula C13H6IN3 and a molecular weight of 331.12 g/mol. Its IUPAC name is 2-iodo-6-phenylpyridine-3,4-dicarbonitrile.
| Compound Name | 2-iodo-6-phenylpyridine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 45123386 |
| Molecular Formula | C13H6IN3 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 2-iodo-6-phenylpyridine-3,4-dicarbonitrile |
| SMILES | N#Cc1cc(-c2ccccc2)nc(I)c1C#N |
| InChI | InChI=1S/C13H6IN3/c14-13-11(8-16)10(7-15)6-12(17-13)9-4-2-1-3-5-9/h1-6H |
| InChIKey | HRGFXHOYIKEAQN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|