C22H19N3 — CID 11099418
4,6-diphenyl-2-pyrrolidin-1-ylpyridine-3-carbonitrile (PubChem CID 11099418) has the molecular formula C22H19N3 and a molecular weight of 325.42 g/mol. Its IUPAC name is 4,6-diphenyl-2-pyrrolidin-1-ylpyridine-3-carbonitrile.
| Compound Name | 4,6-diphenyl-2-pyrrolidin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11099418 |
| Molecular Formula | C22H19N3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 4,6-diphenyl-2-pyrrolidin-1-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccccc2)nc1N1CCCC1 |
| InChI | InChI=1S/C22H19N3/c23-16-20-19(17-9-3-1-4-10-17)15-21(18-11-5-2-6-12-18)24-22(20)25-13-7-8-14-25/h1-6,9-12,15H,7-8,13-14H2 |
| InChIKey | SCSFLKBTRVVNLW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |