C22H20N4 — CID 6403511
5,6-diphenyl-3-piperidin-1-ylpyridazine-4-carbonitrile (PubChem CID 6403511) has the molecular formula C22H20N4 and a molecular weight of 340.43 g/mol. Its IUPAC name is 5,6-diphenyl-3-piperidin-1-ylpyridazine-4-carbonitrile.
| Compound Name | 5,6-diphenyl-3-piperidin-1-ylpyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 6403511 |
| Molecular Formula | C22H20N4 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 5,6-diphenyl-3-piperidin-1-ylpyridazine-4-carbonitrile |
| SMILES | N#Cc1c(N2CCCCC2)nnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H20N4/c23-16-19-20(17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)24-25-22(19)26-14-8-3-9-15-26/h1-2,4-7,10-13H,3,8-9,14-15H2 |
| InChIKey | FICUZZFMNCQQIC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |