C14H16N4 — CID 6401390
6-phenyl-5-piperidin-1-yl-1,2,4-triazine (PubChem CID 6401390) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 6-phenyl-5-piperidin-1-yl-1,2,4-triazine.
| Compound Name | 6-phenyl-5-piperidin-1-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 6401390 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6-phenyl-5-piperidin-1-yl-1,2,4-triazine |
| SMILES | c1ccc(-c2nncnc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C14H16N4/c1-3-7-12(8-4-1)13-14(15-11-16-17-13)18-9-5-2-6-10-18/h1,3-4,7-8,11H,2,5-6,9-10H2 |
| InChIKey | BNAACYNZDAHOTK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |