C13H13ClN4O — CID 6405046
4-[6-(4-chlorophenyl)-1,2,4-triazin-5-yl]morpholine (PubChem CID 6405046) has the molecular formula C13H13ClN4O and a molecular weight of 276.73 g/mol. Its IUPAC name is 4-[6-(4-chlorophenyl)-1,2,4-triazin-5-yl]morpholine.
| Compound Name | 4-[6-(4-chlorophenyl)-1,2,4-triazin-5-yl]morpholine |
|---|---|
| PubChem CID | 6405046 |
| Molecular Formula | C13H13ClN4O |
| Molecular Weight | 276.73 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-[6-(4-chlorophenyl)-1,2,4-triazin-5-yl]morpholine |
| SMILES | Clc1ccc(-c2nncnc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C13H13ClN4O/c14-11-3-1-10(2-4-11)12-13(15-9-16-17-12)18-5-7-19-8-6-18/h1-4,9H,5-8H2 |
| InChIKey | LZNGCZBLHRGAPT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |