C14H17N5 — CID 67364048
5-phenyl-6-piperidin-1-yl-1,2,4-triazin-3-amine (PubChem CID 67364048) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-phenyl-6-piperidin-1-yl-1,2,4-triazin-3-amine.
| Compound Name | 5-phenyl-6-piperidin-1-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 67364048 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 5-phenyl-6-piperidin-1-yl-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(N2CCCCC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H17N5/c15-14-16-12(11-7-3-1-4-8-11)13(17-18-14)19-9-5-2-6-10-19/h1,3-4,7-8H,2,5-6,9-10H2,(H2,15,16,18) |
| InChIKey | KLRVLVDEWSDQFK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |