C16H15N5 — CID 56844240
6-(2,6-dimethyl-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 56844240) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 6-(2,6-dimethyl-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(2,6-dimethyl-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 56844240 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6-(2,6-dimethyl-4-pyridinyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Cc1cc(-c2nnc(N)nc2-c2ccccc2)cc(C)n1 |
| InChI | InChI=1S/C16H15N5/c1-10-8-13(9-11(2)18-10)15-14(19-16(17)21-20-15)12-6-4-3-5-7-12/h3-9H,1-2H3,(H2,17,19,21) |
| InChIKey | SORFNYWLKDSNNF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |