C17H19N3 — CID 14144309
4-methyl-5-phenyl-2-piperidin-1-yl-1H-pyrrole-3-carbonitrile (PubChem CID 14144309) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-methyl-5-phenyl-2-piperidin-1-yl-1H-pyrrole-3-carbonitrile.
| Compound Name | 4-methyl-5-phenyl-2-piperidin-1-yl-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 14144309 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 4-methyl-5-phenyl-2-piperidin-1-yl-1H-pyrrole-3-carbonitrile |
| SMILES | Cc1c(-c2ccccc2)[nH]c(N2CCCCC2)c1C#N |
| InChI | InChI=1S/C17H19N3/c1-13-15(12-18)17(20-10-6-3-7-11-20)19-16(13)14-8-4-2-5-9-14/h2,4-5,8-9,19H,3,6-7,10-11H2,1H3 |
| InChIKey | DKCKHFVGSJQRFG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |