C41H27N3 — CID 168836971
2-[6-phenyl-2-[3-phenyl-5-(4-phenylphenyl)phenyl]pyrimidin-4-yl]benzonitrile (PubChem CID 168836971) has the molecular formula C41H27N3 and a molecular weight of 561.69 g/mol. Its IUPAC name is 2-[6-phenyl-2-[3-phenyl-5-(4-phenylphenyl)phenyl]pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-[6-phenyl-2-[3-phenyl-5-(4-phenylphenyl)phenyl]pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 168836971 |
| Molecular Formula | C41H27N3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 2-[6-phenyl-2-[3-phenyl-5-(4-phenylphenyl)phenyl]pyrimidin-4-yl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1cc(-c2ccccc2)nc(-c2cc(-c3ccccc3)cc(-c3ccc(-c4ccccc4)cc3)c2)n1 |
| InChI | InChI=1S/C41H27N3/c42-28-34-18-10-11-19-38(34)40-27-39(33-16-8-3-9-17-33)43-41(44-40)37-25-35(30-14-6-2-7-15-30)24-36(26-37)32-22-20-31(21-23-32)29-12-4-1-5-13-29/h1-27H |
| InChIKey | RCLXJFXBFMPVHC-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |