C23H15I2N — CID 144989296
4-(3-iodophenyl)-2-(4-iodophenyl)-6-phenylpyridine (PubChem CID 144989296) has the molecular formula C23H15I2N and a molecular weight of 559.19 g/mol. Its IUPAC name is 4-(3-iodophenyl)-2-(4-iodophenyl)-6-phenylpyridine.
| Compound Name | 4-(3-iodophenyl)-2-(4-iodophenyl)-6-phenylpyridine |
|---|---|
| PubChem CID | 144989296 |
| Molecular Formula | C23H15I2N |
| Molecular Weight | 559.19 g/mol |
| Exact Mass | 558.93 |
| IUPAC Name | 4-(3-iodophenyl)-2-(4-iodophenyl)-6-phenylpyridine |
| SMILES | Ic1ccc(-c2cc(-c3cccc(I)c3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H15I2N/c24-20-11-9-17(10-12-20)23-15-19(18-7-4-8-21(25)13-18)14-22(26-23)16-5-2-1-3-6-16/h1-15H |
| InChIKey | SPKXAOMUJMTKQV-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.19 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|