C15H10ClN3O — CID 82342890
5-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridine-3-carbonitrile (PubChem CID 82342890) has the molecular formula C15H10ClN3O and a molecular weight of 283.72 g/mol. Its IUPAC name is 5-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82342890 |
| Molecular Formula | C15H10ClN3O |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 5-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridine-3-carbonitrile |
| SMILES | COc1cccc(-c2nc3cccc(Cl)n3c2C#N)c1 |
| InChI | InChI=1S/C15H10ClN3O/c1-20-11-5-2-4-10(8-11)15-12(9-17)19-13(16)6-3-7-14(19)18-15/h2-8H,1H3 |
| InChIKey | BZXFMWFTKUQQOA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|