C14H11ClN2O — CID 117142201
5-chloro-3-(3-methoxyphenyl)imidazo[1,5-a]pyridine (PubChem CID 117142201) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 5-chloro-3-(3-methoxyphenyl)imidazo[1,5-a]pyridine.
| Compound Name | 5-chloro-3-(3-methoxyphenyl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117142201 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 5-chloro-3-(3-methoxyphenyl)imidazo[1,5-a]pyridine |
| SMILES | COc1cccc(-c2ncc3cccc(Cl)n23)c1 |
| InChI | InChI=1S/C14H11ClN2O/c1-18-12-6-2-4-10(8-12)14-16-9-11-5-3-7-13(15)17(11)14/h2-9H,1H3 |
| InChIKey | RSJLTODADDHWHR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|