C14H13N3O — CID 117142314
3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-5-amine (PubChem CID 117142314) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-5-amine.
| Compound Name | 3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117142314 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-5-amine |
| SMILES | COc1ccc(-c2ncc3cccc(N)n23)cc1 |
| InChI | InChI=1S/C14H13N3O/c1-18-12-7-5-10(6-8-12)14-16-9-11-3-2-4-13(15)17(11)14/h2-9H,15H2,1H3 |
| InChIKey | MDJBKQZTGVCZIP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |