C10H12N4O — CID 35754869
5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-amine (PubChem CID 35754869) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 35754869 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-methyl-1,2,4-triazol-3-amine |
| SMILES | COc1ccc(-c2nnc(N)n2C)cc1 |
| InChI | InChI=1S/C10H12N4O/c1-14-9(12-13-10(14)11)7-3-5-8(15-2)6-4-7/h3-6H,1-2H3,(H2,11,13) |
| InChIKey | ZESJHFRLUPQMQT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |