C9H9ClN4 — CID 35754866
5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-amine (PubChem CID 35754866) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 35754866 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1c(N)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H9ClN4/c1-14-8(12-13-9(14)11)6-2-4-7(10)5-3-6/h2-5H,1H3,(H2,11,13) |
| InChIKey | UMNADBZCQQGENF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |