C13H10ClN5 — CID 24886930
3-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-4-amine (PubChem CID 24886930) has the molecular formula C13H10ClN5 and a molecular weight of 271.71 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-4-amine.
| Compound Name | 3-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 24886930 |
| Molecular Formula | C13H10ClN5 |
| Molecular Weight | 271.71 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(-c2ccncc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClN5/c14-11-3-1-9(2-4-11)12-17-18-13(19(12)15)10-5-7-16-8-6-10/h1-8H,15H2 |
| InChIKey | ZDUQRZGEXDZEBS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |