C11H13ClN4OS — CID 27907937
3-(4-chlorophenyl)-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-4-amine (PubChem CID 27907937) has the molecular formula C11H13ClN4OS and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-(4-chlorophenyl)-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 27907937 |
| Molecular Formula | C11H13ClN4OS |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 3-(4-chlorophenyl)-5-(2-methoxyethylsulfanyl)-1,2,4-triazol-4-amine |
| SMILES | COCCSc1nnc(-c2ccc(Cl)cc2)n1N |
| InChI | InChI=1S/C11H13ClN4OS/c1-17-6-7-18-11-15-14-10(16(11)13)8-2-4-9(12)5-3-8/h2-5H,6-7,13H2,1H3 |
| InChIKey | SGWNHPHZXFOOEN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|