C13H9ClN4 — CID 3736424
4-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]pyridine (PubChem CID 3736424) has the molecular formula C13H9ClN4 and a molecular weight of 256.70 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]pyridine.
| Compound Name | 4-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]pyridine |
|---|---|
| PubChem CID | 3736424 |
| Molecular Formula | C13H9ClN4 |
| Molecular Weight | 256.70 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]pyridine |
| SMILES | Clc1ccc(-n2ncnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C13H9ClN4/c14-11-1-3-12(4-2-11)18-13(16-9-17-18)10-5-7-15-8-6-10/h1-9H |
| InChIKey | VMNMHVIDCDKYQX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |