2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid

C10H8ClN3O2 — CID 84700384

IUPAC2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid
SMILESO=C(O)Cc1ncnn1-c1ccc(Cl)cc1
InChIInChI=1S/C10H8ClN3O2/c11-7-1-3-8(4-2-7)14-9(5-10(15)16)12-6-13-14/h1-4,6H,5H2,(H,15,16)
InChIKeyNLMQNKMYWPGPEI-UHFFFAOYSA-N
MW237.65 g/mol
LogP1.55
Rot. Bonds3

About 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid

2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid (PubChem CID 84700384) has the molecular formula C10H8ClN3O2 and a molecular weight of 237.65 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid
PubChem CID84700384
Molecular FormulaC10H8ClN3O2
Molecular Weight237.65 g/mol
Exact Mass237.03
IUPAC Name2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid
SMILESO=C(O)Cc1ncnn1-c1ccc(Cl)cc1
InChIInChI=1S/C10H8ClN3O2/c11-7-1-3-8(4-2-7)14-9(5-10(15)16)12-6-13-14/h1-4,6H,5H2,(H,15,16)
InChIKeyNLMQNKMYWPGPEI-UHFFFAOYSA-N
XLogP1.55
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.65
LogP ≤ 51.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid?
The IUPAC name of 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid (CID 84700384) is 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid.
What is the SMILES notation for 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid?
The canonical SMILES for 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid is O=C(O)Cc1ncnn1-c1ccc(Cl)cc1.
What is the InChIKey of 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid?
The InChIKey is NLMQNKMYWPGPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O2/c11-7-1-3-8(4-2-7)14-9(5-10(15)16)12-6-13-14/h1-4,6H,5H2,(H,15,16).
What are the key properties of 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid?
2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid has a molecular weight of 237.65 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)-1,2,4-triazol-3-yl]acetic acid is sourced from PubChem (CID 84700384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).