C16H19ClN8S — CID 51279678
6-[1-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 51279678) has the molecular formula C16H19ClN8S and a molecular weight of 390.90 g/mol. Its IUPAC name is 6-[1-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 51279678 |
| Molecular Formula | C16H19ClN8S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 6-[1-[[5-(4-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Sc1nnc(-c2ccc(Cl)cc2)n1C)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C16H19ClN8S/c1-9(12-19-14(18)21-15(20-12)24(2)3)26-16-23-22-13(25(16)4)10-5-7-11(17)8-6-10/h5-9H,1-4H3,(H2,18,19,20,21) |
| InChIKey | HWUAMKMAFBACPX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |