C14H19N9OS — CID 46658459
6-[1-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 46658459) has the molecular formula C14H19N9OS and a molecular weight of 361.44 g/mol. Its IUPAC name is 6-[1-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46658459 |
| Molecular Formula | C14H19N9OS |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 6-[1-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1occc1-c1nnc(SC(C)c2nc(N)nc(N(C)C)n2)n1N |
| InChI | InChI=1S/C14H19N9OS/c1-7-9(5-6-24-7)11-20-21-14(23(11)16)25-8(2)10-17-12(15)19-13(18-10)22(3)4/h5-6,8H,16H2,1-4H3,(H2,15,17,18,19) |
| InChIKey | LJXOMMGALDPJIN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 137.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |