C21H23N9S — CID 42925578
2-N,2-N-dimethyl-6-[1-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 42925578) has the molecular formula C21H23N9S and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[1-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[1-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42925578 |
| Molecular Formula | C21H23N9S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[1-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccccc1-n1c(SC(C)c2nc(N)nc(N(C)C)n2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C21H23N9S/c1-13-8-5-6-10-16(13)30-18(15-9-7-11-23-12-15)27-28-21(30)31-14(2)17-24-19(22)26-20(25-17)29(3)4/h5-12,14H,1-4H3,(H2,22,24,25,26) |
| InChIKey | VYQIMRDJYAQJAU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |