C11H14N4O — CID 104791064
4-(2-methylfuran-3-yl)-6-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 104791064) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(2-methylfuran-3-yl)-6-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-methylfuran-3-yl)-6-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104791064 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-(2-methylfuran-3-yl)-6-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1occc1-c1nc(N)nc(C(C)C)n1 |
| InChI | InChI=1S/C11H14N4O/c1-6(2)9-13-10(15-11(12)14-9)8-4-5-16-7(8)3/h4-6H,1-3H3,(H2,12,13,14,15) |
| InChIKey | HVBVATISZXXPMG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |