C8H8N4O — CID 104791061
4-(2-methylfuran-3-yl)-1,3,5-triazin-2-amine (PubChem CID 104791061) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 4-(2-methylfuran-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-methylfuran-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 104791061 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 4-(2-methylfuran-3-yl)-1,3,5-triazin-2-amine |
| SMILES | Cc1occc1-c1ncnc(N)n1 |
| InChI | InChI=1S/C8H8N4O/c1-5-6(2-3-13-5)7-10-4-11-8(9)12-7/h2-4H,1H3,(H2,9,10,11,12) |
| InChIKey | RHJJRNNUZJCJBV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |