C16H20N8OS — CID 25463956
2-N,2-N-dimethyl-6-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 25463956) has the molecular formula C16H20N8OS and a molecular weight of 372.46 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 25463956 |
| Molecular Formula | C16H20N8OS |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCn1c(SCc2nc(N)nc(N(C)C)n2)nnc1-c1ccoc1C |
| InChI | InChI=1S/C16H20N8OS/c1-5-7-24-13(11-6-8-25-10(11)2)21-22-16(24)26-9-12-18-14(17)20-15(19-12)23(3)4/h5-6,8H,1,7,9H2,2-4H3,(H2,17,18,19,20) |
| InChIKey | OTHIUOIGRBHJTD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 111.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|