C18H20N4O4S2 — CID 34436299
4-[2-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide (PubChem CID 34436299) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-[2-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 34436299 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 4-[2-[[5-(2-methylfuran-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzenesulfonamide |
| SMILES | C=CCn1c(SCCOc2ccc(S(N)(=O)=O)cc2)nnc1-c1ccoc1C |
| InChI | InChI=1S/C18H20N4O4S2/c1-3-9-22-17(16-8-10-25-13(16)2)20-21-18(22)27-12-11-26-14-4-6-15(7-5-14)28(19,23)24/h3-8,10H,1,9,11-12H2,2H3,(H2,19,23,24) |
| InChIKey | HSTKOXHORDLYOY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|