C11H15N5O3S2 — CID 61468859
4-[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide (PubChem CID 61468859) has the molecular formula C11H15N5O3S2 and a molecular weight of 329.41 g/mol. Its IUPAC name is 4-[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 61468859 |
| Molecular Formula | C11H15N5O3S2 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-[2-[(5-amino-4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethoxy]benzenesulfonamide |
| SMILES | Cn1c(N)nnc1SCCOc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H15N5O3S2/c1-16-10(12)14-15-11(16)20-7-6-19-8-2-4-9(5-3-8)21(13,17)18/h2-5H,6-7H2,1H3,(H2,12,14)(H2,13,17,18) |
| InChIKey | JBPHKFBVOTXYMO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|